C23H21ClN4O2 — CID 112800686
3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-(2-naphthalen-2-yloxyethyl)pyridine-2-carboxamide (PubChem CID 112800686) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-(2-naphthalen-2-yloxyethyl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-(2-naphthalen-2-yloxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 112800686 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-(2-naphthalen-2-yloxyethyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(Cl)c(C(=O)NCCOc3ccc4ccccc4c3)n2)n1 |
| InChI | InChI=1S/C23H21ClN4O2/c1-15-13-16(2)28(27-15)21-10-9-20(24)22(26-21)23(29)25-11-12-30-19-8-7-17-5-3-4-6-18(17)14-19/h3-10,13-14H,11-12H2,1-2H3,(H,25,29) |
| InChIKey | NHDGGMSXMQTSLM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|