C15H20ClN5O — CID 119431879
3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-[3-(methylamino)propyl]pyridine-2-carboxamide (PubChem CID 119431879) has the molecular formula C15H20ClN5O and a molecular weight of 321.81 g/mol. Its IUPAC name is 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-[3-(methylamino)propyl]pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-[3-(methylamino)propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 119431879 |
| Molecular Formula | C15H20ClN5O |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 3-chloro-6-(3,5-dimethylpyrazol-1-yl)-N-[3-(methylamino)propyl]pyridine-2-carboxamide |
| SMILES | CNCCCNC(=O)c1nc(-n2nc(C)cc2C)ccc1Cl |
| InChI | InChI=1S/C15H20ClN5O/c1-10-9-11(2)21(20-10)13-6-5-12(16)14(19-13)15(22)18-8-4-7-17-3/h5-6,9,17H,4,7-8H2,1-3H3,(H,18,22) |
| InChIKey | RYXIBYFUURLALG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|