C16H15Cl2NO5 — CID 11280194
3-(2,6-dichlorophenyl)-6-(2-methoxyethoxymethoxy)-3a,6a-dihydrocyclopenta[d][1,2]oxazol-4-one (PubChem CID 11280194) has the molecular formula C16H15Cl2NO5 and a molecular weight of 372.20 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-6-(2-methoxyethoxymethoxy)-3a,6a-dihydrocyclopenta[d][1,2]oxazol-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-6-(2-methoxyethoxymethoxy)-3a,6a-dihydrocyclopenta[d][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 11280194 |
| Molecular Formula | C16H15Cl2NO5 |
| Molecular Weight | 372.20 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-6-(2-methoxyethoxymethoxy)-3a,6a-dihydrocyclopenta[d][1,2]oxazol-4-one |
| SMILES | COCCOCOC1=CC(=O)C2C(c3c(Cl)cccc3Cl)=NOC12 |
| InChI | InChI=1S/C16H15Cl2NO5/c1-21-5-6-22-8-23-12-7-11(20)14-15(19-24-16(12)14)13-9(17)3-2-4-10(13)18/h2-4,7,14,16H,5-6,8H2,1H3 |
| InChIKey | INXJXTXTANQEKT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|