C20H22O5S — CID 11280270
2-[4-[2-[(4-methoxyphenoxy)methyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid (PubChem CID 11280270) has the molecular formula C20H22O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-[4-[2-[(4-methoxyphenoxy)methyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[2-[(4-methoxyphenoxy)methyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 11280270 |
| Molecular Formula | C20H22O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-[4-[2-[(4-methoxyphenoxy)methyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid |
| SMILES | C=C(COc1ccc(OC)cc1)CSc1ccc(OCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C20H22O5S/c1-14(11-24-17-6-4-16(23-3)5-7-17)13-26-18-8-9-19(15(2)10-18)25-12-20(21)22/h4-10H,1,11-13H2,2-3H3,(H,21,22) |
| InChIKey | DRVFLYFIXCWZCU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|