C24H23FN4O3 — CID 112803662
1-[2-(2-fluoroanilino)pyridine-3-carbonyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 112803662) has the molecular formula C24H23FN4O3 and a molecular weight of 434.47 g/mol. Its IUPAC name is 1-[2-(2-fluoroanilino)pyridine-3-carbonyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(2-fluoroanilino)pyridine-3-carbonyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 112803662 |
| Molecular Formula | C24H23FN4O3 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-[2-(2-fluoroanilino)pyridine-3-carbonyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1O)C1CCN(C(=O)c2cccnc2Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C24H23FN4O3/c25-18-7-1-2-8-19(18)27-22-17(6-5-13-26-22)24(32)29-14-11-16(12-15-29)23(31)28-20-9-3-4-10-21(20)30/h1-10,13,16,30H,11-12,14-15H2,(H,26,27)(H,28,31) |
| InChIKey | SPCPXNMCMFOUMR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|