C24H22FN3O3 — CID 78836688
[1-[2-(2-fluoroanilino)pyridine-3-carbonyl]piperidin-4-yl]-(4-hydroxyphenyl)methanone (PubChem CID 78836688) has the molecular formula C24H22FN3O3 and a molecular weight of 419.46 g/mol. Its IUPAC name is [1-[2-(2-fluoroanilino)pyridine-3-carbonyl]piperidin-4-yl]-(4-hydroxyphenyl)methanone.
| Compound Name | [1-[2-(2-fluoroanilino)pyridine-3-carbonyl]piperidin-4-yl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 78836688 |
| Molecular Formula | C24H22FN3O3 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [1-[2-(2-fluoroanilino)pyridine-3-carbonyl]piperidin-4-yl]-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)C1CCN(C(=O)c2cccnc2Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C24H22FN3O3/c25-20-5-1-2-6-21(20)27-23-19(4-3-13-26-23)24(31)28-14-11-17(12-15-28)22(30)16-7-9-18(29)10-8-16/h1-10,13,17,29H,11-12,14-15H2,(H,26,27) |
| InChIKey | YJTOUSBIAFBJRU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |