C19H18N6O3 — CID 11280377
4-[1-[(2E)-2-methoxyimino-2-(3-methoxyphenyl)ethyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 11280377) has the molecular formula C19H18N6O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is 4-[1-[(2E)-2-methoxyimino-2-(3-methoxyphenyl)ethyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[1-[(2E)-2-methoxyimino-2-(3-methoxyphenyl)ethyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 11280377 |
| Molecular Formula | C19H18N6O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 4-[1-[(2E)-2-methoxyimino-2-(3-methoxyphenyl)ethyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | CO/N=C(/Cn1c(-c2nonc2N)nc2ccccc21)c1cccc(OC)c1 |
| InChI | InChI=1S/C19H18N6O3/c1-26-13-7-5-6-12(10-13)15(22-27-2)11-25-16-9-4-3-8-14(16)21-19(25)17-18(20)24-28-23-17/h3-10H,11H2,1-2H3,(H2,20,24)/b22-15- |
| InChIKey | RLKXBCCLWUJQAH-JCMHNJIXSA-N |
| XLogP | 2.73 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|