C19H19ClN6O3 — CID 173038985
N-[2-[2-(4-amino-1,2,5-oxadiazol-3-yl)benzimidazol-1-yl]-1-(4-chlorophenyl)ethylidene]hydroxylamine;methoxymethane (PubChem CID 173038985) has the molecular formula C19H19ClN6O3 and a molecular weight of 414.85 g/mol. Its IUPAC name is N-[2-[2-(4-amino-1,2,5-oxadiazol-3-yl)benzimidazol-1-yl]-1-(4-chlorophenyl)ethylidene]hydroxylamine;methoxymethane.
| Compound Name | N-[2-[2-(4-amino-1,2,5-oxadiazol-3-yl)benzimidazol-1-yl]-1-(4-chlorophenyl)ethylidene]hydroxylamine;methoxymethane |
|---|---|
| PubChem CID | 173038985 |
| Molecular Formula | C19H19ClN6O3 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[2-[2-(4-amino-1,2,5-oxadiazol-3-yl)benzimidazol-1-yl]-1-(4-chlorophenyl)ethylidene]hydroxylamine;methoxymethane |
| SMILES | COC.Nc1nonc1-c1nc2ccccc2n1CC(=NO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClN6O2.C2H6O/c18-11-7-5-10(6-8-11)13(21-25)9-24-14-4-2-1-3-12(14)20-17(24)15-16(19)23-26-22-15;1-3-2/h1-8,25H,9H2,(H2,19,23);1-2H3 |
| InChIKey | BSDHRBWDNOOZTC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|