C24H23F2N3O2 — CID 112804241
2-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-N,2-diphenylacetamide (PubChem CID 112804241) has the molecular formula C24H23F2N3O2 and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-N,2-diphenylacetamide.
| Compound Name | 2-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 112804241 |
| Molecular Formula | C24H23F2N3O2 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-N,2-diphenylacetamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C(C(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23F2N3O2/c1-2-29(16-21(30)28-22-19(25)14-9-15-20(22)26)23(17-10-5-3-6-11-17)24(31)27-18-12-7-4-8-13-18/h3-15,23H,2,16H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | WGOQYPLLLDDYCW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |