C20H22F2N4O3 — CID 112769376
4-[2-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide (PubChem CID 112769376) has the molecular formula C20H22F2N4O3 and a molecular weight of 404.42 g/mol. Its IUPAC name is 4-[2-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide.
| Compound Name | 4-[2-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 112769376 |
| Molecular Formula | C20H22F2N4O3 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 4-[2-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C(C)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C20H22F2N4O3/c1-3-26(11-17(27)25-18-15(21)5-4-6-16(18)22)12(2)20(29)24-14-9-7-13(8-10-14)19(23)28/h4-10,12H,3,11H2,1-2H3,(H2,23,28)(H,24,29)(H,25,27) |
| InChIKey | QQFVRBNBSOQVHT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |