C22H28N4O3 — CID 51171051
2-[[2-(4-acetamidoanilino)-2-oxoethyl]-ethylamino]-N-(2-methylphenyl)propanamide (PubChem CID 51171051) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[[2-(4-acetamidoanilino)-2-oxoethyl]-ethylamino]-N-(2-methylphenyl)propanamide.
| Compound Name | 2-[[2-(4-acetamidoanilino)-2-oxoethyl]-ethylamino]-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 51171051 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-[[2-(4-acetamidoanilino)-2-oxoethyl]-ethylamino]-N-(2-methylphenyl)propanamide |
| SMILES | CCN(CC(=O)Nc1ccc(NC(C)=O)cc1)C(C)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C22H28N4O3/c1-5-26(16(3)22(29)25-20-9-7-6-8-15(20)2)14-21(28)24-19-12-10-18(11-13-19)23-17(4)27/h6-13,16H,5,14H2,1-4H3,(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | KSXKIDUAYLJZKF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |