C23H31N3O2 — CID 78840464
2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-N-[(2-methylphenyl)methyl]propanamide (PubChem CID 78840464) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-N-[(2-methylphenyl)methyl]propanamide.
| Compound Name | 2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-N-[(2-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 78840464 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-N-[(2-methylphenyl)methyl]propanamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)C(C)C(=O)NCc1ccccc1C |
| InChI | InChI=1S/C23H31N3O2/c1-5-14-26(16-22(27)25-21-13-9-7-11-18(21)3)19(4)23(28)24-15-20-12-8-6-10-17(20)2/h6-13,19H,5,14-16H2,1-4H3,(H,24,28)(H,25,27) |
| InChIKey | QQEXQRXBUXFTOT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |