C16H14Cl2FN3OS — CID 112804858
2,4-dichloro-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-5-fluoro-N-methylbenzamide (PubChem CID 112804858) has the molecular formula C16H14Cl2FN3OS and a molecular weight of 386.28 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-5-fluoro-N-methylbenzamide.
| Compound Name | 2,4-dichloro-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-5-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 112804858 |
| Molecular Formula | C16H14Cl2FN3OS |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 2,4-dichloro-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-5-fluoro-N-methylbenzamide |
| SMILES | Cc1cn2c(CN(C)C(=O)c3cc(F)c(Cl)cc3Cl)c(C)nc2s1 |
| InChI | InChI=1S/C16H14Cl2FN3OS/c1-8-6-22-14(9(2)20-16(22)24-8)7-21(3)15(23)10-4-13(19)12(18)5-11(10)17/h4-6H,7H2,1-3H3 |
| InChIKey | PIOSNUNMZDFZHE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|