C19H20BrClN2O2 — CID 112805317
N-(4-bromo-2-chlorophenyl)-2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]acetamide (PubChem CID 112805317) has the molecular formula C19H20BrClN2O2 and a molecular weight of 423.74 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]acetamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 112805317 |
| Molecular Formula | C19H20BrClN2O2 |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]acetamide |
| SMILES | COc1ccc(C(NCC(=O)Nc2ccc(Br)cc2Cl)C2CC2)cc1 |
| InChI | InChI=1S/C19H20BrClN2O2/c1-25-15-7-4-13(5-8-15)19(12-2-3-12)22-11-18(24)23-17-9-6-14(20)10-16(17)21/h4-10,12,19,22H,2-3,11H2,1H3,(H,23,24) |
| InChIKey | TZGCULSFDYWEGE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |