C16H13Br2NO3 — CID 112806046
4-[3-(2,4-dibromophenoxy)-2-hydroxypropoxy]benzonitrile (PubChem CID 112806046) has the molecular formula C16H13Br2NO3 and a molecular weight of 427.09 g/mol. Its IUPAC name is 4-[3-(2,4-dibromophenoxy)-2-hydroxypropoxy]benzonitrile.
| Compound Name | 4-[3-(2,4-dibromophenoxy)-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 112806046 |
| Molecular Formula | C16H13Br2NO3 |
| Molecular Weight | 427.09 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | 4-[3-(2,4-dibromophenoxy)-2-hydroxypropoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCC(O)COc2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C16H13Br2NO3/c17-12-3-6-16(15(18)7-12)22-10-13(20)9-21-14-4-1-11(8-19)2-5-14/h1-7,13,20H,9-10H2 |
| InChIKey | KDIAPPONPGCCKT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.09 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |