C20H20N6O3S — CID 112809366
5-[[4-(2-nitrophenyl)piperazin-1-yl]methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 112809366) has the molecular formula C20H20N6O3S and a molecular weight of 424.49 g/mol. Its IUPAC name is 5-[[4-(2-nitrophenyl)piperazin-1-yl]methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[[4-(2-nitrophenyl)piperazin-1-yl]methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 112809366 |
| Molecular Formula | C20H20N6O3S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 5-[[4-(2-nitrophenyl)piperazin-1-yl]methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1nnc(CN2CCN(c3ccccc3[N+](=O)[O-])CC2)s1 |
| InChI | InChI=1S/C20H20N6O3S/c27-19(21-15-6-2-1-3-7-15)20-23-22-18(30-20)14-24-10-12-25(13-11-24)16-8-4-5-9-17(16)26(28)29/h1-9H,10-14H2,(H,21,27) |
| InChIKey | MULFOQXBMCRECX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|