C20H22N6O4S — CID 112810361
N-(2-nitrophenyl)-3-[4-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperazin-1-yl]propanamide (PubChem CID 112810361) has the molecular formula C20H22N6O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-(2-nitrophenyl)-3-[4-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperazin-1-yl]propanamide.
| Compound Name | N-(2-nitrophenyl)-3-[4-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 112810361 |
| Molecular Formula | C20H22N6O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N-(2-nitrophenyl)-3-[4-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperazin-1-yl]propanamide |
| SMILES | O=C(CCN1CCN(Cc2cc(=O)n3ccsc3n2)CC1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N6O4S/c27-18(22-16-3-1-2-4-17(16)26(29)30)5-6-23-7-9-24(10-8-23)14-15-13-19(28)25-11-12-31-20(25)21-15/h1-4,11-13H,5-10,14H2,(H,22,27) |
| InChIKey | BOHUVBWNQGFPTP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|