C20H17N5O4S2 — CID 46656294
7-[[4-(5-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 46656294) has the molecular formula C20H17N5O4S2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 7-[[4-(5-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[[4-(5-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 46656294 |
| Molecular Formula | C20H17N5O4S2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 7-[[4-(5-nitro-1-benzothiophene-2-carbonyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=C(c1cc2cc([N+](=O)[O-])ccc2s1)N1CCN(Cc2cc(=O)n3ccsc3n2)CC1 |
| InChI | InChI=1S/C20H17N5O4S2/c26-18-11-14(21-20-24(18)7-8-30-20)12-22-3-5-23(6-4-22)19(27)17-10-13-9-15(25(28)29)1-2-16(13)31-17/h1-2,7-11H,3-6,12H2 |
| InChIKey | WWLGGHYTSFXHFT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|