C18H16FIN4O2S — CID 55685953
7-[[4-(4-fluoro-2-iodobenzoyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 55685953) has the molecular formula C18H16FIN4O2S and a molecular weight of 498.32 g/mol. Its IUPAC name is 7-[[4-(4-fluoro-2-iodobenzoyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[[4-(4-fluoro-2-iodobenzoyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 55685953 |
| Molecular Formula | C18H16FIN4O2S |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | 7-[[4-(4-fluoro-2-iodobenzoyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=C(c1ccc(F)cc1I)N1CCN(Cc2cc(=O)n3ccsc3n2)CC1 |
| InChI | InChI=1S/C18H16FIN4O2S/c19-12-1-2-14(15(20)9-12)17(26)23-5-3-22(4-6-23)11-13-10-16(25)24-7-8-27-18(24)21-13/h1-2,7-10H,3-6,11H2 |
| InChIKey | PHHCZZNHTHEZFD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|