C20H25ClFN3O3S — CID 112811392
N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-4-(2-phenoxyethyl)piperazine-1-sulfonamide (PubChem CID 112811392) has the molecular formula C20H25ClFN3O3S and a molecular weight of 441.96 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-4-(2-phenoxyethyl)piperazine-1-sulfonamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-4-(2-phenoxyethyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 112811392 |
| Molecular Formula | C20H25ClFN3O3S |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-4-(2-phenoxyethyl)piperazine-1-sulfonamide |
| SMILES | CN(Cc1c(F)cccc1Cl)S(=O)(=O)N1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C20H25ClFN3O3S/c1-23(16-18-19(21)8-5-9-20(18)22)29(26,27)25-12-10-24(11-13-25)14-15-28-17-6-3-2-4-7-17/h2-9H,10-16H2,1H3 |
| InChIKey | UYQRMRSTPSVIMP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |