C22H16BrFN2O — CID 112812607
N-(4-bromo-2-fluorophenyl)-2-[3-(2-phenylethynyl)anilino]acetamide (PubChem CID 112812607) has the molecular formula C22H16BrFN2O and a molecular weight of 423.29 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-[3-(2-phenylethynyl)anilino]acetamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-[3-(2-phenylethynyl)anilino]acetamide |
|---|---|
| PubChem CID | 112812607 |
| Molecular Formula | C22H16BrFN2O |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-[3-(2-phenylethynyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C#Cc2ccccc2)c1)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C22H16BrFN2O/c23-18-11-12-21(20(24)14-18)26-22(27)15-25-19-8-4-7-17(13-19)10-9-16-5-2-1-3-6-16/h1-8,11-14,25H,15H2,(H,26,27) |
| InChIKey | XBZPSQILUAABBI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|