C24H22N2O — CID 112814826
N-[(4-methylphenyl)methyl]-2-[3-(2-phenylethynyl)anilino]acetamide (PubChem CID 112814826) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-2-[3-(2-phenylethynyl)anilino]acetamide.
| Compound Name | N-[(4-methylphenyl)methyl]-2-[3-(2-phenylethynyl)anilino]acetamide |
|---|---|
| PubChem CID | 112814826 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-2-[3-(2-phenylethynyl)anilino]acetamide |
| SMILES | Cc1ccc(CNC(=O)CNc2cccc(C#Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H22N2O/c1-19-10-12-22(13-11-19)17-26-24(27)18-25-23-9-5-8-21(16-23)15-14-20-6-3-2-4-7-20/h2-13,16,25H,17-18H2,1H3,(H,26,27) |
| InChIKey | BMCNMLZKGAABOJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|