C23H19ClN2O2 — CID 112812610
N-(3-chloro-4-methoxyphenyl)-2-[3-(2-phenylethynyl)anilino]acetamide (PubChem CID 112812610) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[3-(2-phenylethynyl)anilino]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[3-(2-phenylethynyl)anilino]acetamide |
|---|---|
| PubChem CID | 112812610 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[3-(2-phenylethynyl)anilino]acetamide |
| SMILES | COc1ccc(NC(=O)CNc2cccc(C#Cc3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C23H19ClN2O2/c1-28-22-13-12-20(15-21(22)24)26-23(27)16-25-19-9-5-8-18(14-19)11-10-17-6-3-2-4-7-17/h2-9,12-15,25H,16H2,1H3,(H,26,27) |
| InChIKey | BKZIAFCVNSXKKJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|