C16H14ClN3O — CID 26438582
N-[(4-chlorophenyl)methyl]-2-(3-cyanoanilino)acetamide (PubChem CID 26438582) has the molecular formula C16H14ClN3O and a molecular weight of 299.76 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(3-cyanoanilino)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(3-cyanoanilino)acetamide |
|---|---|
| PubChem CID | 26438582 |
| Molecular Formula | C16H14ClN3O |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(3-cyanoanilino)acetamide |
| SMILES | N#Cc1cccc(NCC(=O)NCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H14ClN3O/c17-14-6-4-12(5-7-14)10-20-16(21)11-19-15-3-1-2-13(8-15)9-18/h1-8,19H,10-11H2,(H,20,21) |
| InChIKey | ZZMMISSCHAKTNZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |