C21H25FN2O3S — CID 112812922
N-(cyclopropylmethyl)-2-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-propylbenzamide (PubChem CID 112812922) has the molecular formula C21H25FN2O3S and a molecular weight of 404.51 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-propylbenzamide.
| Compound Name | N-(cyclopropylmethyl)-2-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-propylbenzamide |
|---|---|
| PubChem CID | 112812922 |
| Molecular Formula | C21H25FN2O3S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-(cyclopropylmethyl)-2-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-propylbenzamide |
| SMILES | CCCN(CC1CC1)C(=O)c1ccccc1NS(=O)(=O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C21H25FN2O3S/c1-3-12-24(14-16-8-9-16)21(25)18-6-4-5-7-20(18)23-28(26,27)17-10-11-19(22)15(2)13-17/h4-7,10-11,13,16,23H,3,8-9,12,14H2,1-2H3 |
| InChIKey | VZGNABQTQKLFMV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |