C22H28N2O3S — CID 55350913
N-(cyclopropylmethyl)-2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-propylbenzamide (PubChem CID 55350913) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-propylbenzamide.
| Compound Name | N-(cyclopropylmethyl)-2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 55350913 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(cyclopropylmethyl)-2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-propylbenzamide |
| SMILES | CCCN(CC1CC1)C(=O)c1cc(S(=O)(=O)Nc2cccc(C)c2)ccc1C |
| InChI | InChI=1S/C22H28N2O3S/c1-4-12-24(15-18-9-10-18)22(25)21-14-20(11-8-17(21)3)28(26,27)23-19-7-5-6-16(2)13-19/h5-8,11,13-14,18,23H,4,9-10,12,15H2,1-3H3 |
| InChIKey | FNKWIZYCPUUIRT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |