C22H25F3N2O3S — CID 30768460
2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-[4-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 30768460) has the molecular formula C22H25F3N2O3S and a molecular weight of 454.51 g/mol. Its IUPAC name is 2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-[4-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 30768460 |
| Molecular Formula | C22H25F3N2O3S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(C)c(C(=O)NC3CCC(C(F)(F)F)CC3)c2)c1 |
| InChI | InChI=1S/C22H25F3N2O3S/c1-14-4-3-5-18(12-14)27-31(29,30)19-11-6-15(2)20(13-19)21(28)26-17-9-7-16(8-10-17)22(23,24)25/h3-6,11-13,16-17,27H,7-10H2,1-2H3,(H,26,28) |
| InChIKey | JZRIIDJBSNVSBF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |