C24H27N5O3S — CID 55722019
2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-(1-pyrimidin-2-ylpiperidin-4-yl)benzamide (PubChem CID 55722019) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is 2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-(1-pyrimidin-2-ylpiperidin-4-yl)benzamide.
| Compound Name | 2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-(1-pyrimidin-2-ylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 55722019 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-(1-pyrimidin-2-ylpiperidin-4-yl)benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(C)c(C(=O)NC3CCN(c4ncccn4)CC3)c2)c1 |
| InChI | InChI=1S/C24H27N5O3S/c1-17-5-3-6-20(15-17)28-33(31,32)21-8-7-18(2)22(16-21)23(30)27-19-9-13-29(14-10-19)24-25-11-4-12-26-24/h3-8,11-12,15-16,19,28H,9-10,13-14H2,1-2H3,(H,27,30) |
| InChIKey | XAWVFZWXPQVJQX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |