C27H23N3O2 — CID 11281613
3-[2-(dimethylamino)ethyl]-13-methyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4,6,8,11(15),16,18,20,22-decaene-12,14-dione (PubChem CID 11281613) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-13-methyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4,6,8,11(15),16,18,20,22-decaene-12,14-dione.
| Compound Name | 3-[2-(dimethylamino)ethyl]-13-methyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4,6,8,11(15),16,18,20,22-decaene-12,14-dione |
|---|---|
| PubChem CID | 11281613 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-13-methyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4,6,8,11(15),16,18,20,22-decaene-12,14-dione |
| SMILES | CN(C)CCn1c2ccccc2c2c3c(c4cc5ccccc5cc4c21)C(=O)N(C)C3=O |
| InChI | InChI=1S/C27H23N3O2/c1-28(2)12-13-30-21-11-7-6-10-18(21)22-24-23(26(31)29(3)27(24)32)19-14-16-8-4-5-9-17(16)15-20(19)25(22)30/h4-11,14-15H,12-13H2,1-3H3 |
| InChIKey | DNFBAHJBBYAYSA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|