About 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide
2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide (PubChem CID 11281617) has the molecular formula C25H31N3O3
and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide.
Molecular Properties
| Compound Name | 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide |
| PubChem CID | 11281617 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide |
| SMILES | CCCCN(CCCC)C(=O)Cn1c(C(=O)c2ccccc2)nc2ccc(OC)cc21 |
| InChI | InChI=1S/C25H31N3O3/c1-4-6-15-27(16-7-5-2)23(29)18-28-22-17-20(31-3)13-14-21(22)26-25(28)24(30)19-11-9-8-10-12-19/h8-14,17H,4-7,15-16,18H2,1-3H3 |
| InChIKey | NTNAWCMSGMZTHB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide?
The IUPAC name of 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide (CID 11281617) is 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide.
What is the SMILES notation for 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide?
The canonical SMILES for 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide is CCCCN(CCCC)C(=O)Cn1c(C(=O)c2ccccc2)nc2ccc(OC)cc21.
What is the InChIKey of 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide?
The InChIKey is NTNAWCMSGMZTHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31N3O3/c1-4-6-15-27(16-7-5-2)23(29)18-28-22-17-20(31-3)13-14-21(22)26-25(28)24(30)19-11-9-8-10-12-19/h8-14,17H,4-7,15-16,18H2,1-3H3.
What are the key properties of 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide?
2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide has a molecular weight of 421.54 g/mol, XLogP of 4.70, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzoyl-6-methoxybenzimidazol-1-yl)-N,N-dibutylacetamide is sourced from PubChem (CID 11281617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).