C21H22N2O3 — CID 142985780
1-(2-benzoyl-6-methoxybenzimidazol-1-yl)hexan-2-one (PubChem CID 142985780) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-(2-benzoyl-6-methoxybenzimidazol-1-yl)hexan-2-one.
| Compound Name | 1-(2-benzoyl-6-methoxybenzimidazol-1-yl)hexan-2-one |
|---|---|
| PubChem CID | 142985780 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-(2-benzoyl-6-methoxybenzimidazol-1-yl)hexan-2-one |
| SMILES | CCCCC(=O)Cn1c(C(=O)c2ccccc2)nc2ccc(OC)cc21 |
| InChI | InChI=1S/C21H22N2O3/c1-3-4-10-16(24)14-23-19-13-17(26-2)11-12-18(19)22-21(23)20(25)15-8-6-5-7-9-15/h5-9,11-13H,3-4,10,14H2,1-2H3 |
| InChIKey | GYWASLJIXWFUHR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |