About N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide
N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide (PubChem CID 112817281) has the molecular formula C17H25NO
and a molecular weight of 259.39 g/mol. Its IUPAC name is N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide |
| PubChem CID | 112817281 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)NC2C(C)CCCC2C)c1 |
| InChI | InChI=1S/C17H25NO/c1-11-8-9-12(2)15(10-11)17(19)18-16-13(3)6-5-7-14(16)4/h8-10,13-14,16H,5-7H2,1-4H3,(H,18,19) |
| InChIKey | JOYBCVTYXQFGJL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide?
The IUPAC name of N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide (CID 112817281) is N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide.
What is the SMILES notation for N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide?
The canonical SMILES for N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide is Cc1ccc(C)c(C(=O)NC2C(C)CCCC2C)c1.
What is the InChIKey of N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide?
The InChIKey is JOYBCVTYXQFGJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO/c1-11-8-9-12(2)15(10-11)17(19)18-16-13(3)6-5-7-14(16)4/h8-10,13-14,16H,5-7H2,1-4H3,(H,18,19).
What are the key properties of N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide?
N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide has a molecular weight of 259.39 g/mol, XLogP of 3.86, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethylcyclohexyl)-2,5-dimethylbenzamide is sourced from PubChem (CID 112817281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).