C24H30ClN3O2 — CID 11281781
(2-chloro-4-pyridinyl)-[9-[(2-ethoxyphenyl)methyl]-3,9-diazaspiro[5.5]undecan-3-yl]methanone (PubChem CID 11281781) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-[9-[(2-ethoxyphenyl)methyl]-3,9-diazaspiro[5.5]undecan-3-yl]methanone.
| Compound Name | (2-chloro-4-pyridinyl)-[9-[(2-ethoxyphenyl)methyl]-3,9-diazaspiro[5.5]undecan-3-yl]methanone |
|---|---|
| PubChem CID | 11281781 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (2-chloro-4-pyridinyl)-[9-[(2-ethoxyphenyl)methyl]-3,9-diazaspiro[5.5]undecan-3-yl]methanone |
| SMILES | CCOc1ccccc1CN1CCC2(CC1)CCN(C(=O)c1ccnc(Cl)c1)CC2 |
| InChI | InChI=1S/C24H30ClN3O2/c1-2-30-21-6-4-3-5-20(21)18-27-13-8-24(9-14-27)10-15-28(16-11-24)23(29)19-7-12-26-22(25)17-19/h3-7,12,17H,2,8-11,13-16,18H2,1H3 |
| InChIKey | YQULQZNEONLQEG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|