C18H23N3O3 — CID 56889081
1-[(2-ethoxyphenyl)methyl]-4-imidazol-1-ylpiperidine-4-carboxylic acid (PubChem CID 56889081) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[(2-ethoxyphenyl)methyl]-4-imidazol-1-ylpiperidine-4-carboxylic acid.
| Compound Name | 1-[(2-ethoxyphenyl)methyl]-4-imidazol-1-ylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56889081 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-[(2-ethoxyphenyl)methyl]-4-imidazol-1-ylpiperidine-4-carboxylic acid |
| SMILES | CCOc1ccccc1CN1CCC(C(=O)O)(n2ccnc2)CC1 |
| InChI | InChI=1S/C18H23N3O3/c1-2-24-16-6-4-3-5-15(16)13-20-10-7-18(8-11-20,17(22)23)21-12-9-19-14-21/h3-6,9,12,14H,2,7-8,10-11,13H2,1H3,(H,22,23) |
| InChIKey | CCUTVXXEGAATJU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |