C21H29ClN4O6 — CID 155871130
1-[(2-chlorophenyl)methyl]-4-imidazol-1-yl-N-(2-methoxyethyl)piperidine-4-carboxamide;formic acid (PubChem CID 155871130) has the molecular formula C21H29ClN4O6 and a molecular weight of 468.94 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-4-imidazol-1-yl-N-(2-methoxyethyl)piperidine-4-carboxamide;formic acid.
| Compound Name | 1-[(2-chlorophenyl)methyl]-4-imidazol-1-yl-N-(2-methoxyethyl)piperidine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 155871130 |
| Molecular Formula | C21H29ClN4O6 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-4-imidazol-1-yl-N-(2-methoxyethyl)piperidine-4-carboxamide;formic acid |
| SMILES | COCCNC(=O)C1(n2ccnc2)CCN(Cc2ccccc2Cl)CC1.O=CO.O=CO |
| InChI | InChI=1S/C19H25ClN4O2.2CH2O2/c1-26-13-9-22-18(25)19(24-12-8-21-15-24)6-10-23(11-7-19)14-16-4-2-3-5-17(16)20;2*2-1-3/h2-5,8,12,15H,6-7,9-11,13-14H2,1H3,(H,22,25);2*1H,(H,2,3) |
| InChIKey | KIZPIAUBDQKQCX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|