C20H29N5O6 — CID 155875558
formic acid;4-imidazol-1-yl-N-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)piperidine-4-carboxamide (PubChem CID 155875558) has the molecular formula C20H29N5O6 and a molecular weight of 435.48 g/mol. Its IUPAC name is formic acid;4-imidazol-1-yl-N-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)piperidine-4-carboxamide.
| Compound Name | formic acid;4-imidazol-1-yl-N-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155875558 |
| Molecular Formula | C20H29N5O6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | formic acid;4-imidazol-1-yl-N-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1(n2ccnc2)CCN(Cc2ccncc2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C18H25N5O2.2CH2O2/c1-25-13-9-21-17(24)18(23-12-8-20-15-23)4-10-22(11-5-18)14-16-2-6-19-7-3-16;2*2-1-3/h2-3,6-8,12,15H,4-5,9-11,13-14H2,1H3,(H,21,24);2*1H,(H,2,3) |
| InChIKey | SAFGVIIVNZWNRN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|