C21H29N5O5 — CID 155878922
N-(cyclopropylmethyl)-3-imidazol-1-yl-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide;formic acid (PubChem CID 155878922) has the molecular formula C21H29N5O5 and a molecular weight of 431.49 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-imidazol-1-yl-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide;formic acid.
| Compound Name | N-(cyclopropylmethyl)-3-imidazol-1-yl-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 155878922 |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-(cyclopropylmethyl)-3-imidazol-1-yl-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide;formic acid |
| SMILES | O=C(NCC1CC1)C1(n2ccnc2)CCCN(Cc2ccncc2)C1.O=CO.O=CO |
| InChI | InChI=1S/C19H25N5O.2CH2O2/c25-18(22-12-16-2-3-16)19(24-11-9-21-15-24)6-1-10-23(14-19)13-17-4-7-20-8-5-17;2*2-1-3/h4-5,7-9,11,15-16H,1-3,6,10,12-14H2,(H,22,25);2*1H,(H,2,3) |
| InChIKey | GFRDCCIULAYSTQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|