C20H28N4O2 — CID 155871591
4-imidazol-1-yl-N-(2-methoxyethyl)-1-[(4-methylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 155871591) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-imidazol-1-yl-N-(2-methoxyethyl)-1-[(4-methylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 4-imidazol-1-yl-N-(2-methoxyethyl)-1-[(4-methylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155871591 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 4-imidazol-1-yl-N-(2-methoxyethyl)-1-[(4-methylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1(n2ccnc2)CCN(Cc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C20H28N4O2/c1-17-3-5-18(6-4-17)15-23-11-7-20(8-12-23,24-13-9-21-16-24)19(25)22-10-14-26-2/h3-6,9,13,16H,7-8,10-12,14-15H2,1-2H3,(H,22,25) |
| InChIKey | ZZBPFQSDTXUSHR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|