C19H27N5O4 — CID 171695932
formic acid;4-imidazol-1-yl-N-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)piperidine-4-carboxamide (PubChem CID 171695932) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is formic acid;4-imidazol-1-yl-N-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)piperidine-4-carboxamide.
| Compound Name | formic acid;4-imidazol-1-yl-N-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 171695932 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | formic acid;4-imidazol-1-yl-N-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1(n2ccnc2)CCN(Cc2cccnc2)CC1.O=CO |
| InChI | InChI=1S/C18H25N5O2.CH2O2/c1-25-12-8-21-17(24)18(23-11-7-20-15-23)4-9-22(10-5-18)14-16-3-2-6-19-13-16;2-1-3/h2-3,6-7,11,13,15H,4-5,8-10,12,14H2,1H3,(H,21,24);1H,(H,2,3) |
| InChIKey | YFTFLDBJRVXALZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|