C19H30N6O6S — CID 155874464
formic acid;N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]-1-(1,3-thiazol-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 155874464) has the molecular formula C19H30N6O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is formic acid;N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]-1-(1,3-thiazol-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | formic acid;N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]-1-(1,3-thiazol-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155874464 |
| Molecular Formula | C19H30N6O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | formic acid;N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]-1-(1,3-thiazol-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1(Nc2ccn(C)n2)CCN(Cc2nccs2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C17H26N6O2S.2CH2O2/c1-22-8-3-14(21-22)20-17(16(24)19-6-11-25-2)4-9-23(10-5-17)13-15-18-7-12-26-15;2*2-1-3/h3,7-8,12H,4-6,9-11,13H2,1-2H3,(H,19,24)(H,20,21);2*1H,(H,2,3) |
| InChIKey | MQKRXWXWJMNIRL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|