C22H35N3O5 — CID 171693395
4-anilino-N-(2-methoxyethyl)-1-(oxan-4-ylmethyl)piperidine-4-carboxamide;formic acid (PubChem CID 171693395) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-anilino-N-(2-methoxyethyl)-1-(oxan-4-ylmethyl)piperidine-4-carboxamide;formic acid.
| Compound Name | 4-anilino-N-(2-methoxyethyl)-1-(oxan-4-ylmethyl)piperidine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 171693395 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 4-anilino-N-(2-methoxyethyl)-1-(oxan-4-ylmethyl)piperidine-4-carboxamide;formic acid |
| SMILES | COCCNC(=O)C1(Nc2ccccc2)CCN(CC2CCOCC2)CC1.O=CO |
| InChI | InChI=1S/C21H33N3O3.CH2O2/c1-26-16-11-22-20(25)21(23-19-5-3-2-4-6-19)9-12-24(13-10-21)17-18-7-14-27-15-8-18;2-1-3/h2-6,18,23H,7-17H2,1H3,(H,22,25);1H,(H,2,3) |
| InChIKey | WXDOMHFOTULXCA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|