C16H27N5O4S — CID 155879839
1-cyclopropylsulfonyl-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide (PubChem CID 155879839) has the molecular formula C16H27N5O4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide.
| Compound Name | 1-cyclopropylsulfonyl-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155879839 |
| Molecular Formula | C16H27N5O4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-cyclopropylsulfonyl-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1(Nc2ccn(C)n2)CCN(S(=O)(=O)C2CC2)CC1 |
| InChI | InChI=1S/C16H27N5O4S/c1-20-9-5-14(19-20)18-16(15(22)17-8-12-25-2)6-10-21(11-7-16)26(23,24)13-3-4-13/h5,9,13H,3-4,6-8,10-12H2,1-2H3,(H,17,22)(H,18,19) |
| InChIKey | GFYJFOBGIIMHEA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|