C14H25N5O4S — CID 155870922
N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 155870922) has the molecular formula C14H25N5O4S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 155870922 |
| Molecular Formula | C14H25N5O4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1(Nc2ccn(C)n2)CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C14H25N5O4S/c1-18-8-4-12(17-18)16-14(13(20)15-7-11-23-2)5-9-19(10-6-14)24(3,21)22/h4,8H,5-7,9-11H2,1-3H3,(H,15,20)(H,16,17) |
| InChIKey | DXNGFASZBFLVLG-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|