C18H25N5O4 — CID 155878649
1-(furan-3-carbonyl)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide (PubChem CID 155878649) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-(furan-3-carbonyl)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide.
| Compound Name | 1-(furan-3-carbonyl)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155878649 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-(furan-3-carbonyl)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-3-yl)amino]piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1(Nc2ccn(C)n2)CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C18H25N5O4/c1-22-8-3-15(21-22)20-18(17(25)19-7-12-26-2)5-9-23(10-6-18)16(24)14-4-11-27-13-14/h3-4,8,11,13H,5-7,9-10,12H2,1-2H3,(H,19,25)(H,20,21) |
| InChIKey | GTEWKUZQKKKICD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|