C17H22N4O3S2 — CID 155874048
N-(2-methoxyethyl)-4-(1,3-thiazol-2-ylamino)-1-(thiophene-3-carbonyl)piperidine-4-carboxamide (PubChem CID 155874048) has the molecular formula C17H22N4O3S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(1,3-thiazol-2-ylamino)-1-(thiophene-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-4-(1,3-thiazol-2-ylamino)-1-(thiophene-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155874048 |
| Molecular Formula | C17H22N4O3S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-(2-methoxyethyl)-4-(1,3-thiazol-2-ylamino)-1-(thiophene-3-carbonyl)piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1(Nc2nccs2)CCN(C(=O)c2ccsc2)CC1 |
| InChI | InChI=1S/C17H22N4O3S2/c1-24-9-5-18-15(23)17(20-16-19-6-11-26-16)3-7-21(8-4-17)14(22)13-2-10-25-12-13/h2,6,10-12H,3-5,7-9H2,1H3,(H,18,23)(H,19,20) |
| InChIKey | XDGPVBCDUHFTNO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|