C17H25N5O2S2 — CID 155873912
N-(2-methoxyethyl)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-(1,3-thiazol-2-ylamino)piperidine-4-carboxamide (PubChem CID 155873912) has the molecular formula C17H25N5O2S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-(1,3-thiazol-2-ylamino)piperidine-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-(1,3-thiazol-2-ylamino)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155873912 |
| Molecular Formula | C17H25N5O2S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-(2-methoxyethyl)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-(1,3-thiazol-2-ylamino)piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1(Nc2nccs2)CCN(Cc2scnc2C)CC1 |
| InChI | InChI=1S/C17H25N5O2S2/c1-13-14(26-12-20-13)11-22-7-3-17(4-8-22,15(23)18-5-9-24-2)21-16-19-6-10-25-16/h6,10,12H,3-5,7-9,11H2,1-2H3,(H,18,23)(H,19,21) |
| InChIKey | OBSWZWYPRKAPSO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|