C19H18F2N2O4S2 — CID 112818482
N-[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4-(2-methoxyethoxy)benzenesulfonamide (PubChem CID 112818482) has the molecular formula C19H18F2N2O4S2 and a molecular weight of 440.49 g/mol. Its IUPAC name is N-[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4-(2-methoxyethoxy)benzenesulfonamide.
| Compound Name | N-[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4-(2-methoxyethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 112818482 |
| Molecular Formula | C19H18F2N2O4S2 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4-(2-methoxyethoxy)benzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)Nc2ncc(Cc3ccc(F)c(F)c3)s2)cc1 |
| InChI | InChI=1S/C19H18F2N2O4S2/c1-26-8-9-27-14-3-5-16(6-4-14)29(24,25)23-19-22-12-15(28-19)10-13-2-7-17(20)18(21)11-13/h2-7,11-12H,8-10H2,1H3,(H,22,23) |
| InChIKey | ISFMMCWWIGTMSB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|