C18H14F2N2O4S2 — CID 112812076
methyl 3-[[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]sulfamoyl]benzoate (PubChem CID 112812076) has the molecular formula C18H14F2N2O4S2 and a molecular weight of 424.45 g/mol. Its IUPAC name is methyl 3-[[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]sulfamoyl]benzoate.
| Compound Name | methyl 3-[[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 112812076 |
| Molecular Formula | C18H14F2N2O4S2 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | methyl 3-[[5-[(3,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)Nc2ncc(Cc3ccc(F)c(F)c3)s2)c1 |
| InChI | InChI=1S/C18H14F2N2O4S2/c1-26-17(23)12-3-2-4-14(9-12)28(24,25)22-18-21-10-13(27-18)7-11-5-6-15(19)16(20)8-11/h2-6,8-10H,7H2,1H3,(H,21,22) |
| InChIKey | RRQIVMFWWMUZAQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |