C16H19N3O3S — CID 119766767
methyl 3-[[2-(3-aminobutanoylamino)-1,3-thiazol-5-yl]methyl]benzoate (PubChem CID 119766767) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is methyl 3-[[2-(3-aminobutanoylamino)-1,3-thiazol-5-yl]methyl]benzoate.
| Compound Name | methyl 3-[[2-(3-aminobutanoylamino)-1,3-thiazol-5-yl]methyl]benzoate |
|---|---|
| PubChem CID | 119766767 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | methyl 3-[[2-(3-aminobutanoylamino)-1,3-thiazol-5-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(Cc2cnc(NC(=O)CC(C)N)s2)c1 |
| InChI | InChI=1S/C16H19N3O3S/c1-10(17)6-14(20)19-16-18-9-13(23-16)8-11-4-3-5-12(7-11)15(21)22-2/h3-5,7,9-10H,6,8,17H2,1-2H3,(H,18,19,20) |
| InChIKey | WDVVGFDBDVOUSA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |