C16H11IN2O3 — CID 112819046
1-(4-iodophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)oxy]ethanone (PubChem CID 112819046) has the molecular formula C16H11IN2O3 and a molecular weight of 406.18 g/mol. Its IUPAC name is 1-(4-iodophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)oxy]ethanone.
| Compound Name | 1-(4-iodophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)oxy]ethanone |
|---|---|
| PubChem CID | 112819046 |
| Molecular Formula | C16H11IN2O3 |
| Molecular Weight | 406.18 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 1-(4-iodophenyl)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)oxy]ethanone |
| SMILES | O=C(COc1nnc(-c2ccccc2)o1)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H11IN2O3/c17-13-8-6-11(7-9-13)14(20)10-21-16-19-18-15(22-16)12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | PJCCGGKACLLUNX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.18 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|